Products 2070921-92-3
CAS 2070921-92-3 appears in our catalog under these names: 2-(3-(Trifluoromethyl)phenyl)-1,3,2-dioxaborinane, 98%, 2-(3-(Trifluoromethyl)phenyl)-1,3,2-dioxaborinane, 98%, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 250mg, 1g.
2-[3-(trifluoromethyl)phenyl]-1,3,2-dioxaborinane (CAS 2070921-92-3) is a chemical compound with the molecular formula C10H10BF3O2 and a molecular weight of 229.99 g/mol. IUPAC name: 2-[3-(trifluoromethyl)phenyl]-1,3,2-dioxaborinane. InChIKey: SGLLEQIKPTYENH-UHFFFAOYSA-N.
| Molecular formula | C10H10BF3O2 |
|---|---|
| Molecular weight | 229.99 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)phenyl]-1,3,2-dioxaborinane |
| InChIKey | SGLLEQIKPTYENH-UHFFFAOYSA-N |
| SMILES | B1(OCCCO1)C2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)