Products 416839-38-8
CAS 416839-38-8 appears in our catalog under these names: 4–trifluoromethylbenzeneboronic acid–1，3–propanediol ester, 2-(4-(Trifluoromethyl)phenyl)-1,3,2-dioxaborinane, 98%, 98%, 2-(4-(Trifluoromethyl)phenyl)-1,3,2-dioxaborinane, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
2-[4-(trifluoromethyl)phenyl]-1,3,2-dioxaborinane (CAS 416839-38-8) is a chemical compound with the molecular formula C10H10BF3O2 and a molecular weight of 229.99 g/mol. IUPAC name: 2-[4-(trifluoromethyl)phenyl]-1,3,2-dioxaborinane. InChIKey: LXWREANRGBTZEQ-UHFFFAOYSA-N.
| Molecular formula | C10H10BF3O2 |
|---|---|
| Molecular weight | 229.99 g/mol |
| IUPAC name | 2-[4-(trifluoromethyl)phenyl]-1,3,2-dioxaborinane |
| InChIKey | LXWREANRGBTZEQ-UHFFFAOYSA-N |
| SMILES | B1(OCCCO1)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)