Products 2225174-58-1
CAS 2225174-58-1 is the registry number for (4–cyclopropyl–3–(trifluoromethyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 10mg, 25mg.
[4-cyclopropyl-3-(trifluoromethyl)phenyl]boronic acid (CAS 2225174-58-1) is a chemical compound with the molecular formula C10H10BF3O2 and a molecular weight of 229.99 g/mol. IUPAC name: [4-cyclopropyl-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: QIOVMNROJTZOLV-UHFFFAOYSA-N.
| Molecular formula | C10H10BF3O2 |
|---|---|
| Molecular weight | 229.99 g/mol |
| IUPAC name | [4-cyclopropyl-3-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | QIOVMNROJTZOLV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C2CC2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)