CAS 1431931-52-0 is the registry number for 3-(Chloromethyl)-1,2,4-benzotriazine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-(chloromethyl)-1,2,4-benzotriazine (CAS 1431931-52-0) is a chemical compound with the molecular formula C8H6ClN3 and a molecular weight of 179.60 g/mol. IUPAC name: 3-(chloromethyl)-1,2,4-benzotriazine. InChIKey: YYXVIHJTRIXNQO-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3 |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 3-(chloromethyl)-1,2,4-benzotriazine |
| InChIKey | YYXVIHJTRIXNQO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(N=N2)CCl |
Computed by PubChem (NCBI)