CAS 1431964-06-5 is the registry number for 3-((4-Amino-1H-pyrazol-1-yl)methyl)-4-methoxybenzoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-[(4-aminopyrazol-1-yl)methyl]-4-methoxybenzoic acid;hydrochloride (CAS 1431964-06-5) is a chemical compound with the molecular formula C12H14ClN3O3 and a molecular weight of 283.71 g/mol. IUPAC name: 3-[(4-aminopyrazol-1-yl)methyl]-4-methoxybenzoic acid;hydrochloride. InChIKey: MNAGYWPVLQHRON-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN3O3 |
|---|---|
| Molecular weight | 283.71 g/mol |
| IUPAC name | 3-[(4-aminopyrazol-1-yl)methyl]-4-methoxybenzoic acid;hydrochloride |
| InChIKey | MNAGYWPVLQHRON-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)O)CN2C=C(C=N2)N.Cl |
Computed by PubChem (NCBI)