CAS 2108829-95-2 is the registry number for 2-Amino-6,7-dimethoxyquinoline-3-carboxamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-amino-6,7-dimethoxyquinoline-3-carboxamide;hydrochloride (CAS 2108829-95-2) is a chemical compound with the molecular formula C12H14ClN3O3 and a molecular weight of 283.71 g/mol. IUPAC name: 2-amino-6,7-dimethoxyquinoline-3-carboxamide;hydrochloride. InChIKey: GYDUTCPTJQBSQX-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN3O3 |
|---|---|
| Molecular weight | 283.71 g/mol |
| IUPAC name | 2-amino-6,7-dimethoxyquinoline-3-carboxamide;hydrochloride |
| InChIKey | GYDUTCPTJQBSQX-UHFFFAOYSA-N |
| SMILES | COC1=CC2=CC(=C(N=C2C=C1OC)N)C(=O)N.Cl |
Computed by PubChem (NCBI)