Products 2730879-65-7
CAS 2730879-65-7 is the registry number for Ethyl 2-(4-chloro-7-ethyl-1-oxopyrrolo[1,2-d][1,2,4]triazin-2(1H)-yl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(4-chloro-7-ethyl-1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)acetate (CAS 2730879-65-7) is a chemical compound with the molecular formula C12H14ClN3O3 and a molecular weight of 283.71 g/mol. IUPAC name: ethyl 2-(4-chloro-7-ethyl-1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)acetate. InChIKey: UEAKOYBEDUECSV-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN3O3 |
|---|---|
| Molecular weight | 283.71 g/mol |
| IUPAC name | ethyl 2-(4-chloro-7-ethyl-1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)acetate |
| InChIKey | UEAKOYBEDUECSV-UHFFFAOYSA-N |
| SMILES | CCC1=CN2C(=C1)C(=O)N(N=C2Cl)CC(=O)OCC |
Computed by PubChem (NCBI)