CAS 1798702-20-1 appears in our catalog under these names: Ethyl 5-(3-(aminomethyl)phenyl)-1,2,4-oxadiazole-3-carboxylate hydrochloride, 95%, Ethyl 5-(3-(aminomethyl)phenyl)-1,2,4-oxadiazole-3-carboxylate hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Ethyl 5-[3-(aminomethyl)phenyl]-1,2,4-oxadiazole-3-carboxylate;hydrochloride (CAS 1798702-20-1) is a chemical compound with the molecular formula C12H14ClN3O3 and a molecular weight of 283.71 g/mol. IUPAC name: ethyl 5-[3-(aminomethyl)phenyl]-1,2,4-oxadiazole-3-carboxylate;hydrochloride. InChIKey: KVDICHWATVGGSN-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN3O3 |
|---|---|
| Molecular weight | 283.71 g/mol |
| IUPAC name | ethyl 5-[3-(aminomethyl)phenyl]-1,2,4-oxadiazole-3-carboxylate;hydrochloride |
| InChIKey | KVDICHWATVGGSN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NOC(=N1)C2=CC=CC(=C2)CN.Cl |
Computed by PubChem (NCBI)