Products 143207-76-5
CAS 143207-76-5 appears in our catalog under these names: (Z)–3–Hydroxy–5–methoxystilbene, (Z)-Pinosylvin monomethyl ether. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, Get quote.
3-methoxy-5-[(Z)-2-phenylethenyl]phenol (CAS 143207-76-5) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: 3-methoxy-5-[(Z)-2-phenylethenyl]phenol. InChIKey: JVIXPWIEOVZVJC-FPLPWBNLSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 3-methoxy-5-[(Z)-2-phenylethenyl]phenol |
| InChIKey | JVIXPWIEOVZVJC-FPLPWBNLSA-N |
| SMILES | COC1=CC(=CC(=C1)O)/C=C\C2=CC=CC=C2 |
Computed by PubChem (NCBI)