Products 1432501-15-9
CAS 1432501-15-9 is the registry number for (3S)-2,3-Dihydro-5,7-dihydroxy-3-((4-methoxyphenyl)methyl)-4H-1-benzopyran-4-one,. Offered by: TRC. Available pack sizes: 25mg.
(3S)-5,7-dihydroxy-3-[(4-methoxyphenyl)methyl]-2,3-dihydrochromen-4-one (CAS 1432501-15-9) is a chemical compound with the molecular formula C17H16O5 and a molecular weight of 300.30 g/mol. IUPAC name: (3S)-5,7-dihydroxy-3-[(4-methoxyphenyl)methyl]-2,3-dihydrochromen-4-one. InChIKey: IERGURVELWCYAW-NSHDSACASA-N.
| Molecular formula | C17H16O5 |
|---|---|
| Molecular weight | 300.30 g/mol |
| IUPAC name | (3S)-5,7-dihydroxy-3-[(4-methoxyphenyl)methyl]-2,3-dihydrochromen-4-one |
| InChIKey | IERGURVELWCYAW-NSHDSACASA-N |
| SMILES | COC1=CC=C(C=C1)C[C@H]2COC3=CC(=CC(=C3C2=O)O)O |
Computed by PubChem (NCBI)