Products 61002-27-5
CAS 61002-27-5 appears in our catalog under these names: Fenofibrate Impurity 5, Fenofibrate Impurity 14, 4-Hydroxy Fenofibric Acid, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 50mg.
2-[4-(4-hydroxybenzoyl)phenoxy]-2-methylpropanoic acid (CAS 61002-27-5) is a chemical compound with the molecular formula C17H16O5 and a molecular weight of 300.30 g/mol. IUPAC name: 2-[4-(4-hydroxybenzoyl)phenoxy]-2-methylpropanoic acid. InChIKey: MZTKIKBXDMDCDY-UHFFFAOYSA-N.
| Molecular formula | C17H16O5 |
|---|---|
| Molecular weight | 300.30 g/mol |
| IUPAC name | 2-[4-(4-hydroxybenzoyl)phenoxy]-2-methylpropanoic acid |
| InChIKey | MZTKIKBXDMDCDY-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)OC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)