CAS 1432679-24-7 appears in our catalog under these names: Octahydro-1H-indole-6-sulfonic acid, 98%, Octahydro-1H-indole-6-sulfonic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 0,5g, 50mg.
2,3,3a,4,5,6,7,7a-octahydro-1H-indole-6-sulfonic acid (CAS 1432679-24-7) is a chemical compound with the molecular formula C8H15NO3S and a molecular weight of 205.28 g/mol. IUPAC name: 2,3,3a,4,5,6,7,7a-octahydro-1H-indole-6-sulfonic acid. InChIKey: HJZJFNRYVWVMQL-UHFFFAOYSA-N.
| Molecular formula | C8H15NO3S |
|---|---|
| Molecular weight | 205.28 g/mol |
| IUPAC name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indole-6-sulfonic acid |
| InChIKey | HJZJFNRYVWVMQL-UHFFFAOYSA-N |
| SMILES | C1CC(CC2C1CCN2)S(=O)(=O)O |
Computed by PubChem (NCBI)