CAS 143305-35-5 is the registry number for Aloc-L-Asp(tBu)-OH*DCHA. Offered by: Iris Biotech. Available pack sizes: 1g, 5g.
(2S)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-(prop-2-enoxycarbonylamino)butanoic acid (CAS 143305-35-5) is a chemical compound with the molecular formula C12H19NO6 and a molecular weight of 273.28 g/mol. IUPAC name: (2S)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-(prop-2-enoxycarbonylamino)butanoic acid. InChIKey: CETZXCPLLTVICV-QMMMGPOBSA-N.
| Molecular formula | C12H19NO6 |
|---|---|
| Molecular weight | 273.28 g/mol |
| IUPAC name | (2S)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-(prop-2-enoxycarbonylamino)butanoic acid |
| InChIKey | CETZXCPLLTVICV-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](C(=O)O)NC(=O)OCC=C |
Computed by PubChem (NCBI)