CAS 143381-79-7 appears in our catalog under these names: 2-(5-Methylbenzofuran-2-yl)benzonitrile, 95%, 2–(5–methylbenzofuran–2–yl)benzonitrile. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 100mg, 1g, 250mg.
2-(5-methyl-1-benzofuran-2-yl)benzonitrile (CAS 143381-79-7) is a chemical compound with the molecular formula C16H11NO and a molecular weight of 233.26 g/mol. IUPAC name: 2-(5-methyl-1-benzofuran-2-yl)benzonitrile. InChIKey: OACAGQBRVQSDKA-UHFFFAOYSA-N.
| Molecular formula | C16H11NO |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | 2-(5-methyl-1-benzofuran-2-yl)benzonitrile |
| InChIKey | OACAGQBRVQSDKA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)OC(=C2)C3=CC=CC=C3C#N |
Computed by PubChem (NCBI)