CAS 518058-50-9 is the registry number for 6-(Naphthalen-1-yl)-2-picolinaldehyde. Offered by: TRC. Available pack sizes: 2,5g.
6-naphthalen-1-ylpyridine-2-carbaldehyde (CAS 518058-50-9) is a chemical compound with the molecular formula C16H11NO and a molecular weight of 233.26 g/mol. IUPAC name: 6-naphthalen-1-ylpyridine-2-carbaldehyde. InChIKey: PPPFLBHBKQTOEN-UHFFFAOYSA-N.
| Molecular formula | C16H11NO |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | 6-naphthalen-1-ylpyridine-2-carbaldehyde |
| InChIKey | PPPFLBHBKQTOEN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3=CC=CC(=N3)C=O |
Computed by PubChem (NCBI)