CAS 2281888-57-9 is the registry number for Naphtho[2,3-b]benzofuran-3-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Naphtho[2,3-b][1]benzofuran-3-amine (CAS 2281888-57-9) is a chemical compound with the molecular formula C16H11NO and a molecular weight of 233.26 g/mol. IUPAC name: naphtho[2,3-b][1]benzofuran-3-amine. InChIKey: JQLBSQCYVXUNNP-UHFFFAOYSA-N.
| Molecular formula | C16H11NO |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | naphtho[2,3-b][1]benzofuran-3-amine |
| InChIKey | JQLBSQCYVXUNNP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)C4=C(O3)C=C(C=C4)N |
Computed by PubChem (NCBI)