CAS 258-04-8 is the registry number for 12H-Benzo[b]phenoxazine, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.
12H-benzo[b]phenoxazine (CAS 258-04-8) is a chemical compound with the molecular formula C16H11NO and a molecular weight of 233.26 g/mol. IUPAC name: 12H-benzo[b]phenoxazine. InChIKey: BDDQPKXDNUKVCC-UHFFFAOYSA-N.
| Molecular formula | C16H11NO |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | 12H-benzo[b]phenoxazine |
| InChIKey | BDDQPKXDNUKVCC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)NC4=CC=CC=C4O3 |
Computed by PubChem (NCBI)