CAS 16576-25-3 appears in our catalog under these names: 2-Benzoylquinoline, 95%, 2-Benzoylquinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Phenyl(quinolin-2-yl)methanone (CAS 16576-25-3) is a chemical compound with the molecular formula C16H11NO and a molecular weight of 233.26 g/mol. IUPAC name: phenyl(quinolin-2-yl)methanone. InChIKey: RVBRBIGCROOWOI-UHFFFAOYSA-N.
| Molecular formula | C16H11NO |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | phenyl(quinolin-2-yl)methanone |
| InChIKey | RVBRBIGCROOWOI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=NC3=CC=CC=C3C=C2 |
Computed by PubChem (NCBI)