CAS 14341-78-7 appears in our catalog under these names: L-Glutamine-d5, L-Glutamine-2,3,3,4,4-d5, >95% (HPLC), L-Glutamine-2,3,3,4,4-d5, 98 atom % D, min 98% Chemical Purity, L–Glutamine–d5, L-Glutamine-d5, 99.79%. Offered by: Chemat Brand, TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 2,5mg, 25mg, 0,05g, 0,01g, 1mg, 5mg.
(2S)-2,5-diamino-2,3,3,4,4-pentadeuterio-5-oxopentanoic acid (CAS 14341-78-7) is a chemical compound with the molecular formula C5H10N2O3 and a molecular weight of 151.18 g/mol. IUPAC name: (2S)-2,5-diamino-2,3,3,4,4-pentadeuterio-5-oxopentanoic acid. InChIKey: ZDXPYRJPNDTMRX-NKXUJHECSA-N.
| Molecular formula | C5H10N2O3 |
|---|---|
| Molecular weight | 151.18 g/mol |
| IUPAC name | (2S)-2,5-diamino-2,3,3,4,4-pentadeuterio-5-oxopentanoic acid |
| InChIKey | ZDXPYRJPNDTMRX-NKXUJHECSA-N |
| SMILES | [2H][C@@](C(=O)O)(C([2H])([2H])C([2H])([2H])C(=O)N)N |
Computed by PubChem (NCBI)