CAS 184161-19-1 appears in our catalog under these names: L-Glutamine-13C5, >95% (HPLC), L-Glutamine-13C5, 98% +98%atom%13C, L–Glutamine–13C5, L-Glutamine-¹³C₅, 95% 98%atom%13C, 95% 98%atom%13C, L-Glutamine-13C5, 99.93%. Offered by: TRC, AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 25mg, 5mg, 10mM (in 1ml water), 25 mg, 5 mg, 100 mg.
(2S)-2,5-diamino-5-oxo(513C)pentanoic acid (CAS 184161-19-1) is a chemical compound with the molecular formula C5H10N2O3 and a molecular weight of 147.14 g/mol. IUPAC name: (2S)-2,5-diamino-5-oxo(513C)pentanoic acid. InChIKey: ZDXPYRJPNDTMRX-MYXYCAHRSA-N.
| Molecular formula | C5H10N2O3 |
|---|---|
| Molecular weight | 147.14 g/mol |
| IUPAC name | (2S)-2,5-diamino-5-oxo(513C)pentanoic acid |
| InChIKey | ZDXPYRJPNDTMRX-MYXYCAHRSA-N |
| SMILES | C(C[13C](=O)N)[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)