Products 159680-32-7
CAS 159680-32-7 appears in our catalog under these names: L-Glutamine-5-13C, L-Glutamine-13C, >95% (HPLC), L–Glutamine–5–13C, L-Glutamine-5-13C, 98%, 98%, L-Glutamine-5-13C, 98.0%. Offered by: Chemat Brand, TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: on request, 2,5mg, 25mg, 5mg, 10mg, 1mg, 10 mg, 25 mg.
(2S)-2,5-diamino-5-oxo(513C)pentanoic acid (CAS 159680-32-7) is a chemical compound with the molecular formula C5H10N2O3 and a molecular weight of 147.14 g/mol. IUPAC name: (2S)-2,5-diamino-5-oxo(513C)pentanoic acid. InChIKey: ZDXPYRJPNDTMRX-MYXYCAHRSA-N.
| Molecular formula | C5H10N2O3 |
|---|---|
| Molecular weight | 147.14 g/mol |
| IUPAC name | (2S)-2,5-diamino-5-oxo(513C)pentanoic acid |
| InChIKey | ZDXPYRJPNDTMRX-MYXYCAHRSA-N |
| SMILES | C(C[13C](=O)N)[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)