Products 59681-32-2
CAS 59681-32-2 appears in our catalog under these names: L-Glutamine-amide-¹⁵N, >95% (HPLC), L-Glutamine-amide-15N, >95% (HPLC), L–Glutamine–15N–1, L-GLUTAMINE-AMIDE-15N, 98 ATOM % 15N, L-Glutamine-15N-1, ≥98 atom% 15N,≥98%, ≥98 atom% 15N,≥98%. Offered by: TRC, GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 100mg, 250mg, 25mg, 10mg, 5mg, 50mg, 1G, 10mM/1mL.
(2S)-2-amino-5-(15N)azanyl-5-oxopentanoic acid (CAS 59681-32-2) is a chemical compound with the molecular formula C5H10N2O3 and a molecular weight of 147.14 g/mol. IUPAC name: (2S)-2-amino-5-(15N)azanyl-5-oxopentanoic acid. InChIKey: ZDXPYRJPNDTMRX-QQKKVIQDSA-N.
| Molecular formula | C5H10N2O3 |
|---|---|
| Molecular weight | 147.14 g/mol |
| IUPAC name | (2S)-2-amino-5-(15N)azanyl-5-oxopentanoic acid |
| InChIKey | ZDXPYRJPNDTMRX-QQKKVIQDSA-N |
| SMILES | C(CC(=O)[15NH2])[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)