Products 1434126-87-0
CAS 1434126-87-0 is the registry number for (3S,4S)-1-tert-Butyl 3-ethyl 4-methylpyrrolidine-1,3-dicarboxylate, 95%. Offered by: Chemat. Available pack sizes: 1g.
1-O-tert-butyl 3-O-ethyl (3S,4S)-4-methylpyrrolidine-1,3-dicarboxylate (CAS 1434126-87-0) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl (3S,4S)-4-methylpyrrolidine-1,3-dicarboxylate. InChIKey: QGNVVHOIALIBRL-NXEZZACHSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl (3S,4S)-4-methylpyrrolidine-1,3-dicarboxylate |
| InChIKey | QGNVVHOIALIBRL-NXEZZACHSA-N |
| SMILES | CCOC(=O)[C@@H]1CN(C[C@H]1C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)