CAS 143413-01-8 is the registry number for 4-((1,3-dioxoindan-2-ylidene)methyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 250mg.
4-[(1,3-dioxoinden-2-ylidene)methyl]benzoic acid (CAS 143413-01-8) is a chemical compound with the molecular formula C17H10O4 and a molecular weight of 278.26 g/mol. IUPAC name: 4-[(1,3-dioxoinden-2-ylidene)methyl]benzoic acid. InChIKey: OZERJBZWEUIVKH-UHFFFAOYSA-N.
| Molecular formula | C17H10O4 |
|---|---|
| Molecular weight | 278.26 g/mol |
| IUPAC name | 4-[(1,3-dioxoinden-2-ylidene)methyl]benzoic acid |
| InChIKey | OZERJBZWEUIVKH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=CC3=CC=C(C=C3)C(=O)O)C2=O |
Computed by PubChem (NCBI)