CAS 53865-04-6 is the registry number for 9,11-Dihydroxy-12h-benzo[a]xanthen-12-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
9,11-dihydroxybenzo[a]xanthen-12-one (CAS 53865-04-6) is a chemical compound with the molecular formula C17H10O4 and a molecular weight of 278.26 g/mol. IUPAC name: 9,11-dihydroxybenzo[a]xanthen-12-one. InChIKey: DPSVULZFFRWBMZ-UHFFFAOYSA-N.
| Molecular formula | C17H10O4 |
|---|---|
| Molecular weight | 278.26 g/mol |
| IUPAC name | 9,11-dihydroxybenzo[a]xanthen-12-one |
| InChIKey | DPSVULZFFRWBMZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C(=O)C4=C(C=C(C=C4O3)O)O |
Computed by PubChem (NCBI)