CAS 40462-12-2 is the registry number for (2Z)-2-Benzylidene-1,3-dioxoindane-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
(2Z)-2-benzylidene-1,3-dioxoindene-5-carboxylic acid (CAS 40462-12-2) is a chemical compound with the molecular formula C17H10O4 and a molecular weight of 278.26 g/mol. IUPAC name: (2Z)-2-benzylidene-1,3-dioxoindene-5-carboxylic acid. InChIKey: KAAZONMQZCIBTC-ZSOIEALJSA-N.
| Molecular formula | C17H10O4 |
|---|---|
| Molecular weight | 278.26 g/mol |
| IUPAC name | (2Z)-2-benzylidene-1,3-dioxoindene-5-carboxylic acid |
| InChIKey | KAAZONMQZCIBTC-ZSOIEALJSA-N |
| SMILES | C1=CC=C(C=C1)/C=C\2/C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)