CAS 29874-34-8 is the registry number for 2-(benzo(3,4-d)1,3-dioxolen-5-ylmethylene)indane-1,3-dione. Offered by: Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg.
2-(1,3-benzodioxol-5-ylmethylidene)indene-1,3-dione (CAS 29874-34-8) is a chemical compound with the molecular formula C17H10O4 and a molecular weight of 278.26 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-ylmethylidene)indene-1,3-dione. InChIKey: KFHYAPITKWBLHB-UHFFFAOYSA-N.
| Molecular formula | C17H10O4 |
|---|---|
| Molecular weight | 278.26 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-ylmethylidene)indene-1,3-dione |
| InChIKey | KFHYAPITKWBLHB-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C=C3C(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)