CAS 38183-12-9 appears in our catalog under these names: Fluorescamine, Fluorescamine, >95% (HPLC), Fluorescamine/ 99.1% (existing batch purity), Fluorescamine (Ro 20–7234), Fluorescamine . Offered by: Chemat Brand, TRC, TargetMol, Chemat, GLPBio. Available pack sizes: on request, 100mg, 1g, 250mg, 25mg, 50mg, 10mM (in 1ml dmso), 500mg.
4'-phenylspiro[2-benzofuran-3,2'-furan]-1,3'-dione (CAS 38183-12-9) is a chemical compound with the molecular formula C17H10O4 and a molecular weight of 278.26 g/mol. IUPAC name: 4'-phenylspiro[2-benzofuran-3,2'-furan]-1,3'-dione. InChIKey: ZFKJVJIDPQDDFY-UHFFFAOYSA-N.
| Molecular formula | C17H10O4 |
|---|---|
| Molecular weight | 278.26 g/mol |
| IUPAC name | 4'-phenylspiro[2-benzofuran-3,2'-furan]-1,3'-dione |
| InChIKey | ZFKJVJIDPQDDFY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=COC3(C2=O)C4=CC=CC=C4C(=O)O3 |
Computed by PubChem (NCBI)