CAS 1435934-26-1 appears in our catalog under these names: Dehydronorketamine Hydrochloride, Dehydronorketamine Hydrochloride 0.1 mg/ml in Acetonitrile (as free base). Offered by: TRC, Mikromol, LoGiCal. Available pack sizes: 50mg, 25mg, 10mg, 1ml.
6-amino-6-(2-chlorophenyl)cyclohex-2-en-1-one;hydrochloride (CAS 1435934-26-1) is a chemical compound with the molecular formula C12H13Cl2NO and a molecular weight of 258.14 g/mol. IUPAC name: 6-amino-6-(2-chlorophenyl)cyclohex-2-en-1-one;hydrochloride. InChIKey: WQWIJCRGQUZVJW-UHFFFAOYSA-N.
| Molecular formula | C12H13Cl2NO |
|---|---|
| Molecular weight | 258.14 g/mol |
| IUPAC name | 6-amino-6-(2-chlorophenyl)cyclohex-2-en-1-one;hydrochloride |
| InChIKey | WQWIJCRGQUZVJW-UHFFFAOYSA-N |
| SMILES | C1CC(C(=O)C=C1)(C2=CC=CC=C2Cl)N.Cl |
Computed by PubChem (NCBI)