CAS 294194-11-9 is the registry number for 1-(3,5-Dichlorobenzoyl)piperidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(3,5-dichlorophenyl)-piperidin-1-ylmethanone (CAS 294194-11-9) is a chemical compound with the molecular formula C12H13Cl2NO and a molecular weight of 258.14 g/mol. IUPAC name: (3,5-dichlorophenyl)-piperidin-1-ylmethanone. InChIKey: VFEQRWZEMGXQOY-UHFFFAOYSA-N.
| Molecular formula | C12H13Cl2NO |
|---|---|
| Molecular weight | 258.14 g/mol |
| IUPAC name | (3,5-dichlorophenyl)-piperidin-1-ylmethanone |
| InChIKey | VFEQRWZEMGXQOY-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)