CAS 301226-05-1 is the registry number for 2,4-Dichloro-n-cyclopentylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,4-dichloro-N-cyclopentylbenzamide (CAS 301226-05-1) is a chemical compound with the molecular formula C12H13Cl2NO and a molecular weight of 258.14 g/mol. IUPAC name: 2,4-dichloro-N-cyclopentylbenzamide. InChIKey: DZWHHCWYVZBASG-UHFFFAOYSA-N.
| Molecular formula | C12H13Cl2NO |
|---|---|
| Molecular weight | 258.14 g/mol |
| IUPAC name | 2,4-dichloro-N-cyclopentylbenzamide |
| InChIKey | DZWHHCWYVZBASG-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NC(=O)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)