Products 1788984-22-4
CAS 1788984-22-4 is the registry number for 1-(2,4-Dichlorophenyl)cyclopentanecarboxamide, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(2,4-dichlorophenyl)cyclopentane-1-carboxamide (CAS 1788984-22-4) is a chemical compound with the molecular formula C12H13Cl2NO and a molecular weight of 258.14 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)cyclopentane-1-carboxamide. InChIKey: HERRQBUYJNMOEY-UHFFFAOYSA-N.
| Molecular formula | C12H13Cl2NO |
|---|---|
| Molecular weight | 258.14 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)cyclopentane-1-carboxamide |
| InChIKey | HERRQBUYJNMOEY-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=C(C=C(C=C2)Cl)Cl)C(=O)N |
Computed by PubChem (NCBI)