CAS 916031-18-0 is the registry number for 1-[(2,3-Dichlorophenyl)carbonyl]piperidine, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(2,3-dichlorophenyl)-piperidin-1-ylmethanone (CAS 916031-18-0) is a chemical compound with the molecular formula C12H13Cl2NO and a molecular weight of 258.14 g/mol. IUPAC name: (2,3-dichlorophenyl)-piperidin-1-ylmethanone. InChIKey: UJGRQQZTZHREML-UHFFFAOYSA-N.
| Molecular formula | C12H13Cl2NO |
|---|---|
| Molecular weight | 258.14 g/mol |
| IUPAC name | (2,3-dichlorophenyl)-piperidin-1-ylmethanone |
| InChIKey | UJGRQQZTZHREML-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)