CAS 143617-89-4 is the registry number for 3-((tert-Butoxycarbonyl)amino)-2-methylbenzoic acid, 95+%. Offered by: AmBeed. Available pack sizes: 250mg, 100mg.
2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 143617-89-4) is a chemical compound with the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. IUPAC name: 2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: YFZNLQZFKWVDIH-UHFFFAOYSA-N.
| Molecular formula | C13H17NO4 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| InChIKey | YFZNLQZFKWVDIH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1NC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)