CAS 1436426-80-0 is the registry number for tert-butyl N-[(1R)-1-carbamoyl-2-hydroxyethyl]carbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl N-[(2R)-1-amino-3-hydroxy-1-oxopropan-2-yl]carbamate (CAS 1436426-80-0) is a chemical compound with the molecular formula C8H16N2O4 and a molecular weight of 204.22 g/mol. IUPAC name: tert-butyl N-[(2R)-1-amino-3-hydroxy-1-oxopropan-2-yl]carbamate. InChIKey: PXCFTDPQUDVHDK-RXMQYKEDSA-N.
| Molecular formula | C8H16N2O4 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | tert-butyl N-[(2R)-1-amino-3-hydroxy-1-oxopropan-2-yl]carbamate |
| InChIKey | PXCFTDPQUDVHDK-RXMQYKEDSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO)C(=O)N |
Computed by PubChem (NCBI)