Products 80312-69-2

CAS 80312-69-2 is the registry number for tert-butyl N-[(1S)-1-carbamoyl-2-hydroxyethyl]carbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(2S)-1-amino-3-hydroxy-1-oxopropan-2-yl]carbamate (CAS 80312-69-2) is a chemical compound with the molecular formula C8H16N2O4 and a molecular weight of 204.22 g/mol. IUPAC name: tert-butyl N-[(2S)-1-amino-3-hydroxy-1-oxopropan-2-yl]carbamate. InChIKey: PXCFTDPQUDVHDK-YFKPBYRVSA-N.

Identity
Molecular formulaC8H16N2O4
Molecular weight204.22 g/mol
IUPAC nametert-butyl N-[(2S)-1-amino-3-hydroxy-1-oxopropan-2-yl]carbamate
InChIKeyPXCFTDPQUDVHDK-YFKPBYRVSA-N
SMILESCC(C)(C)OC(=O)N[C@@H](CO)C(=O)N

Computed by PubChem (NCBI)