CAS 14366-21-3 is the registry number for 2,6-Dichloro-1,5-naphthalenediamine. Offered by: TRC. Available pack sizes: 100mg.
2,6-dichloronaphthalene-1,5-diamine (CAS 14366-21-3) is a chemical compound with the molecular formula C10H8Cl2N2 and a molecular weight of 227.09 g/mol. IUPAC name: 2,6-dichloronaphthalene-1,5-diamine. InChIKey: PXKRRFUSCQACAU-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N2 |
|---|---|
| Molecular weight | 227.09 g/mol |
| IUPAC name | 2,6-dichloronaphthalene-1,5-diamine |
| InChIKey | PXKRRFUSCQACAU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=C(C=C2)Cl)N)N)Cl |
Computed by PubChem (NCBI)