CAS 14375-27-0 is the registry number for Dimethyl 2,3,5,6-tetramethylterephthalate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
Dimethyl 2,3,5,6-tetramethylbenzene-1,4-dicarboxylate (CAS 14375-27-0) is a chemical compound with the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. IUPAC name: dimethyl 2,3,5,6-tetramethylbenzene-1,4-dicarboxylate. InChIKey: STTLSBBIBVBSII-UHFFFAOYSA-N.
| Molecular formula | C14H18O4 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | dimethyl 2,3,5,6-tetramethylbenzene-1,4-dicarboxylate |
| InChIKey | STTLSBBIBVBSII-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C(=O)OC)C)C)C(=O)OC)C |
Computed by PubChem (NCBI)