Products 1437794-65-4
CAS 1437794-65-4 is the registry number for Methyl 5-bromo-2-(cyanomethyl)benzoate, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 5-bromo-2-(cyanomethyl)benzoate (CAS 1437794-65-4) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: methyl 5-bromo-2-(cyanomethyl)benzoate. InChIKey: DOONJSGQWUACSJ-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | methyl 5-bromo-2-(cyanomethyl)benzoate |
| InChIKey | DOONJSGQWUACSJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)Br)CC#N |
Computed by PubChem (NCBI)