Products 1438382-08-1

CAS 1438382-08-1 is the registry number for 4-(Oxolan-3-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-(oxolan-3-yl)benzoic acid (CAS 1438382-08-1) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 4-(oxolan-3-yl)benzoic acid. InChIKey: VYZCMKNCOWQPAD-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12O3
Molecular weight192.21 g/mol
IUPAC name4-(oxolan-3-yl)benzoic acid
InChIKeyVYZCMKNCOWQPAD-UHFFFAOYSA-N
SMILESC1COCC1C2=CC=C(C=C2)C(=O)O

Computed by PubChem (NCBI)