CAS 1438858-62-8 is the registry number for tert-Butyl 3-(benzo[d][1,3]dioxol-5-yl)-3-hydroxyazetidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-(1,3-benzodioxol-5-yl)-3-hydroxyazetidine-1-carboxylate (CAS 1438858-62-8) is a chemical compound with the molecular formula C15H19NO5 and a molecular weight of 293.31 g/mol. IUPAC name: tert-butyl 3-(1,3-benzodioxol-5-yl)-3-hydroxyazetidine-1-carboxylate. InChIKey: UQMSYOYTAUFACA-UHFFFAOYSA-N.
| Molecular formula | C15H19NO5 |
|---|---|
| Molecular weight | 293.31 g/mol |
| IUPAC name | tert-butyl 3-(1,3-benzodioxol-5-yl)-3-hydroxyazetidine-1-carboxylate |
| InChIKey | UQMSYOYTAUFACA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(C2=CC3=C(C=C2)OCO3)O |
Computed by PubChem (NCBI)