Products 1438888-11-9
CAS 1438888-11-9 is the registry number for (5-Isopropoxy-2-methoxyphenyl)boronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2-methoxy-5-propan-2-yloxyphenyl)boronic acid (CAS 1438888-11-9) is a chemical compound with the molecular formula C10H15BO4 and a molecular weight of 210.04 g/mol. IUPAC name: (2-methoxy-5-propan-2-yloxyphenyl)boronic acid. InChIKey: IXKKMHVURSGIKC-UHFFFAOYSA-N.
| Molecular formula | C10H15BO4 |
|---|---|
| Molecular weight | 210.04 g/mol |
| IUPAC name | (2-methoxy-5-propan-2-yloxyphenyl)boronic acid |
| InChIKey | IXKKMHVURSGIKC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OC(C)C)OC)(O)O |
Computed by PubChem (NCBI)