Products 143924-48-5

CAS 143924-48-5 is the registry number for rac-Anabasine DiHCl (rac-Nicotine EP Impurity G DiHCl). Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-piperidin-2-ylpyridine;dihydrochloride (CAS 143924-48-5) is a chemical compound with the molecular formula C10H16Cl2N2 and a molecular weight of 235.15 g/mol. IUPAC name: 3-piperidin-2-ylpyridine;dihydrochloride. InChIKey: YVAXNODSVITPGV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16Cl2N2
Molecular weight235.15 g/mol
IUPAC name3-piperidin-2-ylpyridine;dihydrochloride
InChIKeyYVAXNODSVITPGV-UHFFFAOYSA-N
SMILESC1CCNC(C1)C2=CN=CC=C2.Cl.Cl

Computed by PubChem (NCBI)