CAS 143924-48-5 is the registry number for rac-Anabasine DiHCl (rac-Nicotine EP Impurity G DiHCl). Offered by: Chemat Brand. Available pack sizes: on request.
3-piperidin-2-ylpyridine;dihydrochloride (CAS 143924-48-5) is a chemical compound with the molecular formula C10H16Cl2N2 and a molecular weight of 235.15 g/mol. IUPAC name: 3-piperidin-2-ylpyridine;dihydrochloride. InChIKey: YVAXNODSVITPGV-UHFFFAOYSA-N.
| Molecular formula | C10H16Cl2N2 |
|---|---|
| Molecular weight | 235.15 g/mol |
| IUPAC name | 3-piperidin-2-ylpyridine;dihydrochloride |
| InChIKey | YVAXNODSVITPGV-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)C2=CN=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)