Products 1439366-88-7
CAS 1439366-88-7 appears in our catalog under these names: ARN 077 (enantiomer), ARN 077 (enantiomer), 99%, 99%, ARN 077 (enantiomer), 99.40%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 1mg, 10mM/1mL, 10 mg, 5 mg, 1 mg.
5-phenylpentyl N-[(2R,3S)-2-methyl-4-oxooxetan-3-yl]carbamate (CAS 1439366-88-7) is a chemical compound with the molecular formula C16H21NO4 and a molecular weight of 291.34 g/mol. IUPAC name: 5-phenylpentyl N-[(2R,3S)-2-methyl-4-oxooxetan-3-yl]carbamate. InChIKey: PTVDTLVLQXSSEC-OCCSQVGLSA-N.
| Molecular formula | C16H21NO4 |
|---|---|
| Molecular weight | 291.34 g/mol |
| IUPAC name | 5-phenylpentyl N-[(2R,3S)-2-methyl-4-oxooxetan-3-yl]carbamate |
| InChIKey | PTVDTLVLQXSSEC-OCCSQVGLSA-N |
| SMILES | C[C@@H]1[C@@H](C(=O)O1)NC(=O)OCCCCCC2=CC=CC=C2 |
Computed by PubChem (NCBI)