CAS 1439896-64-6 is the registry number for 2-[2-(Trifluoromethyl)phenyl]propan-2-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
2-[2-(trifluoromethyl)phenyl]propan-2-amine;hydrochloride (CAS 1439896-64-6) is a chemical compound with the molecular formula C10H13ClF3N and a molecular weight of 239.66 g/mol. IUPAC name: 2-[2-(trifluoromethyl)phenyl]propan-2-amine;hydrochloride. InChIKey: HXCAGYCYNVISRX-UHFFFAOYSA-N.
| Molecular formula | C10H13ClF3N |
|---|---|
| Molecular weight | 239.66 g/mol |
| IUPAC name | 2-[2-(trifluoromethyl)phenyl]propan-2-amine;hydrochloride |
| InChIKey | HXCAGYCYNVISRX-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CC=C1C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)