Products 2989151-70-2
CAS 2989151-70-2 appears in our catalog under these names: (R)-4,4,4-trifluoro-1-phenylbutan-1-amine hydrochloride, 95%, (R)-4,4,4-trifluoro-1-phenylbutan-1-amine hydrochloride, >95%, >95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg.
(1R)-4,4,4-trifluoro-1-phenylbutan-1-amine;hydrochloride (CAS 2989151-70-2) is a chemical compound with the molecular formula C10H13ClF3N and a molecular weight of 239.66 g/mol. IUPAC name: (1R)-4,4,4-trifluoro-1-phenylbutan-1-amine;hydrochloride. InChIKey: KGEDBZHKHHOIDO-SBSPUUFOSA-N.
| Molecular formula | C10H13ClF3N |
|---|---|
| Molecular weight | 239.66 g/mol |
| IUPAC name | (1R)-4,4,4-trifluoro-1-phenylbutan-1-amine;hydrochloride |
| InChIKey | KGEDBZHKHHOIDO-SBSPUUFOSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](CCC(F)(F)F)N.Cl |
Computed by PubChem (NCBI)