CAS 15996-89-1 appears in our catalog under these names: 1-[4-(Trifluoromethyl)phenyl]-1-methylethylamine hydrochloride, 97%, 2-(4-(Trifluoromethyl)phenyl)propan-2-amine hydrochloride, 95%, 2-(4-(Trifluoromethyl)phenyl)propan-2-amine hydrochloride, 97%, 2-(4-(Trifluoromethyl)phenyl)propan-2-amine hydrochloride, 97%, 97%. Offered by: Fluorochem, Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 10g, 5g, 100mg.
2-[4-(trifluoromethyl)phenyl]propan-2-amine;hydrochloride (CAS 15996-89-1) is a chemical compound with the molecular formula C10H13ClF3N and a molecular weight of 239.66 g/mol. IUPAC name: 2-[4-(trifluoromethyl)phenyl]propan-2-amine;hydrochloride. InChIKey: OXXGECQGZOBRIM-UHFFFAOYSA-N.
| Molecular formula | C10H13ClF3N |
|---|---|
| Molecular weight | 239.66 g/mol |
| IUPAC name | 2-[4-(trifluoromethyl)phenyl]propan-2-amine;hydrochloride |
| InChIKey | OXXGECQGZOBRIM-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)