CAS 1864062-04-3 appears in our catalog under these names: 1–(3–(Trifluoromethyl)phenyl)propan–1–amine hydrochloride, 1-(3-(Trifluoromethyl)phenyl)propan-1-amine hydrochloride, 95%, 1-(3-(Trifluoromethyl)phenyl)propan-1-amine hydrochloride, 95%, 95%. Offered by: GLPBio, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-[3-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride (CAS 1864062-04-3) is a chemical compound with the molecular formula C10H13ClF3N and a molecular weight of 239.66 g/mol. IUPAC name: 1-[3-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride. InChIKey: SYWGBBJGWIEQAM-UHFFFAOYSA-N.
| Molecular formula | C10H13ClF3N |
|---|---|
| Molecular weight | 239.66 g/mol |
| IUPAC name | 1-[3-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride |
| InChIKey | SYWGBBJGWIEQAM-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC(=CC=C1)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)