CAS 79314-52-6 appears in our catalog under these names: 2-[3-(Trifluoromethyl)phenyl]propan-1-amine hydrochloride, 95%, 2-(3-(Trifluoromethyl)phenyl)propan-1-amine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100mg, 250mg, 0,5g, 50mg.
2-[3-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride (CAS 79314-52-6) is a chemical compound with the molecular formula C10H13ClF3N and a molecular weight of 239.66 g/mol. IUPAC name: 2-[3-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride. InChIKey: VSBGLGYGCYTUTB-UHFFFAOYSA-N.
| Molecular formula | C10H13ClF3N |
|---|---|
| Molecular weight | 239.66 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride |
| InChIKey | VSBGLGYGCYTUTB-UHFFFAOYSA-N |
| SMILES | CC(CN)C1=CC(=CC=C1)C(F)(F)F.Cl |
Computed by PubChem (NCBI)