Products 1439905-31-3
CAS 1439905-31-3 appears in our catalog under these names: 2–(3，4–difluorophenyl)propan–2–amine hydrochloride, 2-(3,4-Difluorophenyl)propan-2-amine hydrochloride. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g.
2-(3,4-difluorophenyl)propan-2-amine;hydrochloride (CAS 1439905-31-3) is a chemical compound with the molecular formula C9H12ClF2N and a molecular weight of 207.65 g/mol. IUPAC name: 2-(3,4-difluorophenyl)propan-2-amine;hydrochloride. InChIKey: NGKPOSAGINGUAL-UHFFFAOYSA-N.
| Molecular formula | C9H12ClF2N |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | 2-(3,4-difluorophenyl)propan-2-amine;hydrochloride |
| InChIKey | NGKPOSAGINGUAL-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=C(C=C1)F)F)N.Cl |
Computed by PubChem (NCBI)